C24H28N2O3 — CID 18408746
5-octyl-1,5-diphenyl-1,3-diazinane-2,4,6-trione (PubChem CID 18408746) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is 5-octyl-1,5-diphenyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-octyl-1,5-diphenyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 18408746 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | 5-octyl-1,5-diphenyl-1,3-diazinane-2,4,6-trione |
| SMILES | CCCCCCCCC1(c2ccccc2)C(=O)NC(=O)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C24H28N2O3/c1-2-3-4-5-6-13-18-24(19-14-9-7-10-15-19)21(27)25-23(29)26(22(24)28)20-16-11-8-12-17-20/h7-12,14-17H,2-6,13,18H2,1H3,(H,25,27,29) |
| InChIKey | YYZDSGPCEYPHSA-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|