C30H26N4O2 — CID 18409865
2-(1-benzofuran-2-ylmethylamino)-3-(1H-indol-3-yl)-N-(quinolin-3-ylmethyl)propanamide (PubChem CID 18409865) has the molecular formula C30H26N4O2 and a molecular weight of 474.56 g/mol. Its IUPAC name is 2-(1-benzofuran-2-ylmethylamino)-3-(1H-indol-3-yl)-N-(quinolin-3-ylmethyl)propanamide.
| Compound Name | 2-(1-benzofuran-2-ylmethylamino)-3-(1H-indol-3-yl)-N-(quinolin-3-ylmethyl)propanamide |
|---|---|
| PubChem CID | 18409865 |
| Molecular Formula | C30H26N4O2 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | 2-(1-benzofuran-2-ylmethylamino)-3-(1H-indol-3-yl)-N-(quinolin-3-ylmethyl)propanamide |
| SMILES | O=C(NCc1cnc2ccccc2c1)C(Cc1c[nH]c2ccccc12)NCc1cc2ccccc2o1 |
| InChI | InChI=1S/C30H26N4O2/c35-30(34-17-20-13-21-7-1-4-10-26(21)31-16-20)28(15-23-18-32-27-11-5-3-9-25(23)27)33-19-24-14-22-8-2-6-12-29(22)36-24/h1-14,16,18,28,32-33H,15,17,19H2,(H,34,35) |
| InChIKey | JEWQBWCZZDQUBC-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |