C26H29N3O2 — CID 18409629
2-(1-benzofuran-2-ylmethylamino)-N-cyclohexyl-3-(1H-indol-3-yl)propanamide (PubChem CID 18409629) has the molecular formula C26H29N3O2 and a molecular weight of 415.54 g/mol. Its IUPAC name is 2-(1-benzofuran-2-ylmethylamino)-N-cyclohexyl-3-(1H-indol-3-yl)propanamide.
| Compound Name | 2-(1-benzofuran-2-ylmethylamino)-N-cyclohexyl-3-(1H-indol-3-yl)propanamide |
|---|---|
| PubChem CID | 18409629 |
| Molecular Formula | C26H29N3O2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | 2-(1-benzofuran-2-ylmethylamino)-N-cyclohexyl-3-(1H-indol-3-yl)propanamide |
| SMILES | O=C(NC1CCCCC1)C(Cc1c[nH]c2ccccc12)NCc1cc2ccccc2o1 |
| InChI | InChI=1S/C26H29N3O2/c30-26(29-20-9-2-1-3-10-20)24(15-19-16-27-23-12-6-5-11-22(19)23)28-17-21-14-18-8-4-7-13-25(18)31-21/h4-8,11-14,16,20,24,27-28H,1-3,9-10,15,17H2,(H,29,30) |
| InChIKey | QWCFOYZTTUIJFA-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 70.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |