About 2-morpholin-4-ylethyl 4-(methoxymethyl)-9H-pyrido[3,4-b]indole-3-carboxylate
2-morpholin-4-ylethyl 4-(methoxymethyl)-9H-pyrido[3,4-b]indole-3-carboxylate (PubChem CID 18412226) has the molecular formula C20H23N3O4
and a molecular weight of 369.42 g/mol. Its IUPAC name is 2-morpholin-4-ylethyl 4-(methoxymethyl)-9H-pyrido[3,4-b]indole-3-carboxylate.
Molecular Properties
| Compound Name | 2-morpholin-4-ylethyl 4-(methoxymethyl)-9H-pyrido[3,4-b]indole-3-carboxylate |
| PubChem CID | 18412226 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 2-morpholin-4-ylethyl 4-(methoxymethyl)-9H-pyrido[3,4-b]indole-3-carboxylate |
| SMILES | COCc1c(C(=O)OCCN2CCOCC2)ncc2[nH]c3ccccc3c12 |
| InChI | InChI=1S/C20H23N3O4/c1-25-13-15-18-14-4-2-3-5-16(14)22-17(18)12-21-19(15)20(24)27-11-8-23-6-9-26-10-7-23/h2-5,12,22H,6-11,13H2,1H3 |
| InChIKey | DAMJPELYQXBINN-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-morpholin-4-ylethyl 4-(methoxymethyl)-9H-pyrido[3,4-b]indole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-morpholin-4-ylethyl 4-(methoxymethyl)-9H-pyrido[3,4-b]indole-3-carboxylate?
The IUPAC name of 2-morpholin-4-ylethyl 4-(methoxymethyl)-9H-pyrido[3,4-b]indole-3-carboxylate (CID 18412226) is 2-morpholin-4-ylethyl 4-(methoxymethyl)-9H-pyrido[3,4-b]indole-3-carboxylate.
What is the SMILES notation for 2-morpholin-4-ylethyl 4-(methoxymethyl)-9H-pyrido[3,4-b]indole-3-carboxylate?
The canonical SMILES for 2-morpholin-4-ylethyl 4-(methoxymethyl)-9H-pyrido[3,4-b]indole-3-carboxylate is COCc1c(C(=O)OCCN2CCOCC2)ncc2[nH]c3ccccc3c12.
What is the InChIKey of 2-morpholin-4-ylethyl 4-(methoxymethyl)-9H-pyrido[3,4-b]indole-3-carboxylate?
The InChIKey is DAMJPELYQXBINN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23N3O4/c1-25-13-15-18-14-4-2-3-5-16(14)22-17(18)12-21-19(15)20(24)27-11-8-23-6-9-26-10-7-23/h2-5,12,22H,6-11,13H2,1H3.
What are the key properties of 2-morpholin-4-ylethyl 4-(methoxymethyl)-9H-pyrido[3,4-b]indole-3-carboxylate?
2-morpholin-4-ylethyl 4-(methoxymethyl)-9H-pyrido[3,4-b]indole-3-carboxylate has a molecular weight of 369.42 g/mol, XLogP of 2.35, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-morpholin-4-ylethyl 4-(methoxymethyl)-9H-pyrido[3,4-b]indole-3-carboxylate is sourced from PubChem (CID 18412226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).