C26H23Cl2N3O3 — CID 18412242
3-(2-oxopyrrolidin-1-yl)propyl 9-[(2,5-dichlorophenyl)methyl]pyrido[3,4-b]indole-3-carboxylate (PubChem CID 18412242) has the molecular formula C26H23Cl2N3O3 and a molecular weight of 496.39 g/mol. Its IUPAC name is 3-(2-oxopyrrolidin-1-yl)propyl 9-[(2,5-dichlorophenyl)methyl]pyrido[3,4-b]indole-3-carboxylate.
| Compound Name | 3-(2-oxopyrrolidin-1-yl)propyl 9-[(2,5-dichlorophenyl)methyl]pyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 18412242 |
| Molecular Formula | C26H23Cl2N3O3 |
| Molecular Weight | 496.39 g/mol |
| Exact Mass | 495.11 |
| IUPAC Name | 3-(2-oxopyrrolidin-1-yl)propyl 9-[(2,5-dichlorophenyl)methyl]pyrido[3,4-b]indole-3-carboxylate |
| SMILES | O=C(OCCCN1CCCC1=O)c1cc2c3ccccc3n(Cc3cc(Cl)ccc3Cl)c2cn1 |
| InChI | InChI=1S/C26H23Cl2N3O3/c27-18-8-9-21(28)17(13-18)16-31-23-6-2-1-5-19(23)20-14-22(29-15-24(20)31)26(33)34-12-4-11-30-10-3-7-25(30)32/h1-2,5-6,8-9,13-15H,3-4,7,10-12,16H2 |
| InChIKey | IUGIYZBQKXVSDO-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.39 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|