C10H14O — CID 18414980
2-[(E)-but-1-en-3-ynyl]cyclohexan-1-ol (PubChem CID 18414980) has the molecular formula C10H14O and a molecular weight of 150.22 g/mol. Its IUPAC name is 2-[(E)-but-1-en-3-ynyl]cyclohexan-1-ol.
| Compound Name | 2-[(E)-but-1-en-3-ynyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 18414980 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | 2-[(E)-but-1-en-3-ynyl]cyclohexan-1-ol |
| SMILES | C#C/C=C/C1CCCCC1O |
| InChI | InChI=1S/C10H14O/c1-2-3-6-9-7-4-5-8-10(9)11/h1,3,6,9-11H,4-5,7-8H2/b6-3+ |
| InChIKey | IAMDICYDQISQRI-ZZXKWVIFSA-N |
| XLogP | 1.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|