C18H26O4S — CID 18415200
10-(1-benzofuran-3-yl)decane-1-sulfonic acid (PubChem CID 18415200) has the molecular formula C18H26O4S and a molecular weight of 338.47 g/mol. Its IUPAC name is 10-(1-benzofuran-3-yl)decane-1-sulfonic acid.
| Compound Name | 10-(1-benzofuran-3-yl)decane-1-sulfonic acid |
|---|---|
| PubChem CID | 18415200 |
| Molecular Formula | C18H26O4S |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 10-(1-benzofuran-3-yl)decane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCCCCCCCCCc1coc2ccccc12 |
| InChI | InChI=1S/C18H26O4S/c19-23(20,21)14-10-6-4-2-1-3-5-7-11-16-15-22-18-13-9-8-12-17(16)18/h8-9,12-13,15H,1-7,10-11,14H2,(H,19,20,21) |
| InChIKey | ZESVFZAOAIZMEO-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|