C26H25N3O5 — CID 18416617
4-[3-benzyl-2,5-dioxo-1-(4-phenoxyphenyl)imidazolidin-4-yl]-N-hydroxybutanamide (PubChem CID 18416617) has the molecular formula C26H25N3O5 and a molecular weight of 459.50 g/mol. Its IUPAC name is 4-[3-benzyl-2,5-dioxo-1-(4-phenoxyphenyl)imidazolidin-4-yl]-N-hydroxybutanamide.
| Compound Name | 4-[3-benzyl-2,5-dioxo-1-(4-phenoxyphenyl)imidazolidin-4-yl]-N-hydroxybutanamide |
|---|---|
| PubChem CID | 18416617 |
| Molecular Formula | C26H25N3O5 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | 4-[3-benzyl-2,5-dioxo-1-(4-phenoxyphenyl)imidazolidin-4-yl]-N-hydroxybutanamide |
| SMILES | O=C(CCCC1C(=O)N(c2ccc(Oc3ccccc3)cc2)C(=O)N1Cc1ccccc1)NO |
| InChI | InChI=1S/C26H25N3O5/c30-24(27-33)13-7-12-23-25(31)29(26(32)28(23)18-19-8-3-1-4-9-19)20-14-16-22(17-15-20)34-21-10-5-2-6-11-21/h1-6,8-11,14-17,23,33H,7,12-13,18H2,(H,27,30) |
| InChIKey | JYXBVSQZKNOBLU-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|