C19H17N3O2 — CID 18416669
[2-(1-benzylindazol-3-yl)-4-methyl-1,3-oxazol-5-yl]methanol (PubChem CID 18416669) has the molecular formula C19H17N3O2 and a molecular weight of 319.36 g/mol. Its IUPAC name is [2-(1-benzylindazol-3-yl)-4-methyl-1,3-oxazol-5-yl]methanol.
| Compound Name | [2-(1-benzylindazol-3-yl)-4-methyl-1,3-oxazol-5-yl]methanol |
|---|---|
| PubChem CID | 18416669 |
| Molecular Formula | C19H17N3O2 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | [2-(1-benzylindazol-3-yl)-4-methyl-1,3-oxazol-5-yl]methanol |
| SMILES | Cc1nc(-c2nn(Cc3ccccc3)c3ccccc23)oc1CO |
| InChI | InChI=1S/C19H17N3O2/c1-13-17(12-23)24-19(20-13)18-15-9-5-6-10-16(15)22(21-18)11-14-7-3-2-4-8-14/h2-10,23H,11-12H2,1H3 |
| InChIKey | HOBXQGLRSHZNPT-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |