About sodium 1-benzylindazol-3-olate
sodium 1-benzylindazol-3-olate (PubChem CID 23691647) has the molecular formula C14H11N2NaO
and a molecular weight of 246.25 g/mol. Its IUPAC name is sodium 1-benzylindazol-3-olate.
Molecular Properties
| Compound Name | sodium 1-benzylindazol-3-olate |
| PubChem CID | 23691647 |
| Molecular Formula | C14H11N2NaO |
| Molecular Weight | 246.25 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | sodium 1-benzylindazol-3-olate |
| SMILES | [Na+].[O-]c1nn(Cc2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C14H12N2O.Na/c17-14-12-8-4-5-9-13(12)16(15-14)10-11-6-2-1-3-7-11;/h1-9H,10H2,(H,15,17);/q;+1/p-1 |
| InChIKey | POYTWGDRMIVNEF-UHFFFAOYSA-M |
| XLogP | -0.84 |
| TPSA | 40.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.25 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze sodium 1-benzylindazol-3-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 1-benzylindazol-3-olate?
The IUPAC name of sodium 1-benzylindazol-3-olate (CID 23691647) is sodium 1-benzylindazol-3-olate.
What is the SMILES notation for sodium 1-benzylindazol-3-olate?
The canonical SMILES for sodium 1-benzylindazol-3-olate is [Na+].[O-]c1nn(Cc2ccccc2)c2ccccc12.
What is the InChIKey of sodium 1-benzylindazol-3-olate?
The InChIKey is POYTWGDRMIVNEF-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H12N2O.Na/c17-14-12-8-4-5-9-13(12)16(15-14)10-11-6-2-1-3-7-11;/h1-9H,10H2,(H,15,17);/q;+1/p-1.
What are the key properties of sodium 1-benzylindazol-3-olate?
sodium 1-benzylindazol-3-olate has a molecular weight of 246.25 g/mol, XLogP of -0.84, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 1-benzylindazol-3-olate is sourced from PubChem (CID 23691647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).