C11H12BrNO4S — CID 18416890
4-(4-bromophenyl)sulfanyl-5-(hydroxyamino)-5-oxopentanoic acid (PubChem CID 18416890) has the molecular formula C11H12BrNO4S and a molecular weight of 334.19 g/mol. Its IUPAC name is 4-(4-bromophenyl)sulfanyl-5-(hydroxyamino)-5-oxopentanoic acid.
| Compound Name | 4-(4-bromophenyl)sulfanyl-5-(hydroxyamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18416890 |
| Molecular Formula | C11H12BrNO4S |
| Molecular Weight | 334.19 g/mol |
| Exact Mass | 332.97 |
| IUPAC Name | 4-(4-bromophenyl)sulfanyl-5-(hydroxyamino)-5-oxopentanoic acid |
| SMILES | O=C(O)CCC(Sc1ccc(Br)cc1)C(=O)NO |
| InChI | InChI=1S/C11H12BrNO4S/c12-7-1-3-8(4-2-7)18-9(11(16)13-17)5-6-10(14)15/h1-4,9,17H,5-6H2,(H,13,16)(H,14,15) |
| InChIKey | ZOJVKQZSMGWXKI-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.19 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|