C15H7F2N3O2S — CID 18422266
2-(4,5-difluoro-2-nitroanilino)-1-benzothiophene-3-carbonitrile (PubChem CID 18422266) has the molecular formula C15H7F2N3O2S and a molecular weight of 331.30 g/mol. Its IUPAC name is 2-(4,5-difluoro-2-nitroanilino)-1-benzothiophene-3-carbonitrile.
| Compound Name | 2-(4,5-difluoro-2-nitroanilino)-1-benzothiophene-3-carbonitrile |
|---|---|
| PubChem CID | 18422266 |
| Molecular Formula | C15H7F2N3O2S |
| Molecular Weight | 331.30 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | 2-(4,5-difluoro-2-nitroanilino)-1-benzothiophene-3-carbonitrile |
| SMILES | N#Cc1c(Nc2cc(F)c(F)cc2[N+](=O)[O-])sc2ccccc12 |
| InChI | InChI=1S/C15H7F2N3O2S/c16-10-5-12(13(20(21)22)6-11(10)17)19-15-9(7-18)8-3-1-2-4-14(8)23-15/h1-6,19H |
| InChIKey | RCUISCLKUPFARM-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 78.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.30 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|