C14H6F5N3O2 — CID 58625964
2-(4,5-difluoro-2-nitroanilino)-5-(trifluoromethyl)benzonitrile (PubChem CID 58625964) has the molecular formula C14H6F5N3O2 and a molecular weight of 343.21 g/mol. Its IUPAC name is 2-(4,5-difluoro-2-nitroanilino)-5-(trifluoromethyl)benzonitrile.
| Compound Name | 2-(4,5-difluoro-2-nitroanilino)-5-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 58625964 |
| Molecular Formula | C14H6F5N3O2 |
| Molecular Weight | 343.21 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | 2-(4,5-difluoro-2-nitroanilino)-5-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1cc(C(F)(F)F)ccc1Nc1cc(F)c(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H6F5N3O2/c15-9-4-12(13(22(23)24)5-10(9)16)21-11-2-1-8(14(17,18)19)3-7(11)6-20/h1-5,21H |
| InChIKey | MUQLKSRGWCTFTJ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 78.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.21 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|