C21H23N5O2 — CID 18422760
8-amino-3-benzyl-1-(1H-imidazol-5-ylmethyl)-3,5-dihydro-2H-1,4-benzodiazepine-4-carboxylic acid (PubChem CID 18422760) has the molecular formula C21H23N5O2 and a molecular weight of 377.45 g/mol. Its IUPAC name is 8-amino-3-benzyl-1-(1H-imidazol-5-ylmethyl)-3,5-dihydro-2H-1,4-benzodiazepine-4-carboxylic acid.
| Compound Name | 8-amino-3-benzyl-1-(1H-imidazol-5-ylmethyl)-3,5-dihydro-2H-1,4-benzodiazepine-4-carboxylic acid |
|---|---|
| PubChem CID | 18422760 |
| Molecular Formula | C21H23N5O2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | 8-amino-3-benzyl-1-(1H-imidazol-5-ylmethyl)-3,5-dihydro-2H-1,4-benzodiazepine-4-carboxylic acid |
| SMILES | Nc1ccc2c(c1)N(Cc1cnc[nH]1)CC(Cc1ccccc1)N(C(=O)O)C2 |
| InChI | InChI=1S/C21H23N5O2/c22-17-7-6-16-11-26(21(27)28)19(8-15-4-2-1-3-5-15)13-25(20(16)9-17)12-18-10-23-14-24-18/h1-7,9-10,14,19H,8,11-13,22H2,(H,23,24)(H,27,28) |
| InChIKey | RGHGDXPBHPMEQP-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 98.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|