C20H25FN4O — CID 18423147
N-[[2-amino-4-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]phenyl]methyl]acetamide (PubChem CID 18423147) has the molecular formula C20H25FN4O and a molecular weight of 356.45 g/mol. Its IUPAC name is N-[[2-amino-4-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]phenyl]methyl]acetamide.
| Compound Name | N-[[2-amino-4-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 18423147 |
| Molecular Formula | C20H25FN4O |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | N-[[2-amino-4-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]phenyl]methyl]acetamide |
| SMILES | CC(=O)NCc1ccc(CN2CCN(c3ccc(F)cc3)CC2)cc1N |
| InChI | InChI=1S/C20H25FN4O/c1-15(26)23-13-17-3-2-16(12-20(17)22)14-24-8-10-25(11-9-24)19-6-4-18(21)5-7-19/h2-7,12H,8-11,13-14,22H2,1H3,(H,23,26) |
| InChIKey | XQIBLAVQOLATMX-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|