C22H28ClN3O — CID 18425385
4-chloro-N-[2-[2-(3,4,5-trimethylpiperazin-1-yl)phenyl]ethyl]benzamide (PubChem CID 18425385) has the molecular formula C22H28ClN3O and a molecular weight of 385.94 g/mol. Its IUPAC name is 4-chloro-N-[2-[2-(3,4,5-trimethylpiperazin-1-yl)phenyl]ethyl]benzamide.
| Compound Name | 4-chloro-N-[2-[2-(3,4,5-trimethylpiperazin-1-yl)phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 18425385 |
| Molecular Formula | C22H28ClN3O |
| Molecular Weight | 385.94 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 4-chloro-N-[2-[2-(3,4,5-trimethylpiperazin-1-yl)phenyl]ethyl]benzamide |
| SMILES | CC1CN(c2ccccc2CCNC(=O)c2ccc(Cl)cc2)CC(C)N1C |
| InChI | InChI=1S/C22H28ClN3O/c1-16-14-26(15-17(2)25(16)3)21-7-5-4-6-18(21)12-13-24-22(27)19-8-10-20(23)11-9-19/h4-11,16-17H,12-15H2,1-3H3,(H,24,27) |
| InChIKey | MTNQOOKCFFHDRS-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.94 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |