About 6-(5,6-dichloro-1H-benzimidazol-2-yl)pyridine-3-carbaldehyde
6-(5,6-dichloro-1H-benzimidazol-2-yl)pyridine-3-carbaldehyde (PubChem CID 18426842) has the molecular formula C13H7Cl2N3O
and a molecular weight of 292.12 g/mol. Its IUPAC name is 6-(5,6-dichloro-1H-benzimidazol-2-yl)pyridine-3-carbaldehyde.
Molecular Properties
| Compound Name | 6-(5,6-dichloro-1H-benzimidazol-2-yl)pyridine-3-carbaldehyde |
| PubChem CID | 18426842 |
| Molecular Formula | C13H7Cl2N3O |
| Molecular Weight | 292.12 g/mol |
| Exact Mass | 291.00 |
| IUPAC Name | 6-(5,6-dichloro-1H-benzimidazol-2-yl)pyridine-3-carbaldehyde |
| SMILES | O=Cc1ccc(-c2nc3cc(Cl)c(Cl)cc3[nH]2)nc1 |
| InChI | InChI=1S/C13H7Cl2N3O/c14-8-3-11-12(4-9(8)15)18-13(17-11)10-2-1-7(6-19)5-16-10/h1-6H,(H,17,18) |
| InChIKey | KRNHHZJXZPMOEF-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.12 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 6-(5,6-dichloro-1H-benzimidazol-2-yl)pyridine-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(5,6-dichloro-1H-benzimidazol-2-yl)pyridine-3-carbaldehyde?
The IUPAC name of 6-(5,6-dichloro-1H-benzimidazol-2-yl)pyridine-3-carbaldehyde (CID 18426842) is 6-(5,6-dichloro-1H-benzimidazol-2-yl)pyridine-3-carbaldehyde.
What is the SMILES notation for 6-(5,6-dichloro-1H-benzimidazol-2-yl)pyridine-3-carbaldehyde?
The canonical SMILES for 6-(5,6-dichloro-1H-benzimidazol-2-yl)pyridine-3-carbaldehyde is O=Cc1ccc(-c2nc3cc(Cl)c(Cl)cc3[nH]2)nc1.
What is the InChIKey of 6-(5,6-dichloro-1H-benzimidazol-2-yl)pyridine-3-carbaldehyde?
The InChIKey is KRNHHZJXZPMOEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7Cl2N3O/c14-8-3-11-12(4-9(8)15)18-13(17-11)10-2-1-7(6-19)5-16-10/h1-6H,(H,17,18).
What are the key properties of 6-(5,6-dichloro-1H-benzimidazol-2-yl)pyridine-3-carbaldehyde?
6-(5,6-dichloro-1H-benzimidazol-2-yl)pyridine-3-carbaldehyde has a molecular weight of 292.12 g/mol, XLogP of 3.74, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(5,6-dichloro-1H-benzimidazol-2-yl)pyridine-3-carbaldehyde is sourced from PubChem (CID 18426842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).