C12H20N2 — CID 18428592
2-(cyclohexen-1-yl)-3,4,5,6-tetrahydro-2H-azepin-7-amine (PubChem CID 18428592) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 2-(cyclohexen-1-yl)-3,4,5,6-tetrahydro-2H-azepin-7-amine.
| Compound Name | 2-(cyclohexen-1-yl)-3,4,5,6-tetrahydro-2H-azepin-7-amine |
|---|---|
| PubChem CID | 18428592 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 2-(cyclohexen-1-yl)-3,4,5,6-tetrahydro-2H-azepin-7-amine |
| SMILES | NC1=NC(C2=CCCCC2)CCCC1 |
| InChI | InChI=1S/C12H20N2/c13-12-9-5-4-8-11(14-12)10-6-2-1-3-7-10/h6,11H,1-5,7-9H2,(H2,13,14) |
| InChIKey | YHIRIKJLOMSTNW-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|