C10H18N2 — CID 23378577
2-but-3-enyl-3,4,5,6-tetrahydro-2H-azepin-7-amine (PubChem CID 23378577) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is 2-but-3-enyl-3,4,5,6-tetrahydro-2H-azepin-7-amine.
| Compound Name | 2-but-3-enyl-3,4,5,6-tetrahydro-2H-azepin-7-amine |
|---|---|
| PubChem CID | 23378577 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 2-but-3-enyl-3,4,5,6-tetrahydro-2H-azepin-7-amine |
| SMILES | C=CCCC1CCCCC(N)=N1 |
| InChI | InChI=1S/C10H18N2/c1-2-3-6-9-7-4-5-8-10(11)12-9/h2,9H,1,3-8H2,(H2,11,12) |
| InChIKey | PLWIRDPAOGPRFR-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|