C21H19N3O4 — CID 18431146
1-(3,5-dimethylphenyl)-3-[2-(4-nitrophenoxy)phenyl]urea (PubChem CID 18431146) has the molecular formula C21H19N3O4 and a molecular weight of 377.40 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-3-[2-(4-nitrophenoxy)phenyl]urea.
| Compound Name | 1-(3,5-dimethylphenyl)-3-[2-(4-nitrophenoxy)phenyl]urea |
|---|---|
| PubChem CID | 18431146 |
| Molecular Formula | C21H19N3O4 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-3-[2-(4-nitrophenoxy)phenyl]urea |
| SMILES | Cc1cc(C)cc(NC(=O)Nc2ccccc2Oc2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C21H19N3O4/c1-14-11-15(2)13-16(12-14)22-21(25)23-19-5-3-4-6-20(19)28-18-9-7-17(8-10-18)24(26)27/h3-13H,1-2H3,(H2,22,23,25) |
| InChIKey | YLCCRQWTIKEJQM-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|