About 1-(3,5-dimethylphenyl)-3-[2-(4-nitrophenoxy)phenyl]urea
1-(3,5-dimethylphenyl)-3-[2-(4-nitrophenoxy)phenyl]urea (PubChem CID 18431146) has the molecular formula C21H19N3O4
and a molecular weight of 377.40 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-3-[2-(4-nitrophenoxy)phenyl]urea.
Molecular Properties
| Compound Name | 1-(3,5-dimethylphenyl)-3-[2-(4-nitrophenoxy)phenyl]urea |
| PubChem CID | 18431146 |
| Molecular Formula | C21H19N3O4 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-3-[2-(4-nitrophenoxy)phenyl]urea |
| SMILES | Cc1cc(C)cc(NC(=O)Nc2ccccc2Oc2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C21H19N3O4/c1-14-11-15(2)13-16(12-14)22-21(25)23-19-5-3-4-6-20(19)28-18-9-7-17(8-10-18)24(26)27/h3-13H,1-2H3,(H2,22,23,25) |
| InChIKey | YLCCRQWTIKEJQM-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,5-dimethylphenyl)-3-[2-(4-nitrophenoxy)phenyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,5-dimethylphenyl)-3-[2-(4-nitrophenoxy)phenyl]urea?
The IUPAC name of 1-(3,5-dimethylphenyl)-3-[2-(4-nitrophenoxy)phenyl]urea (CID 18431146) is 1-(3,5-dimethylphenyl)-3-[2-(4-nitrophenoxy)phenyl]urea.
What is the SMILES notation for 1-(3,5-dimethylphenyl)-3-[2-(4-nitrophenoxy)phenyl]urea?
The canonical SMILES for 1-(3,5-dimethylphenyl)-3-[2-(4-nitrophenoxy)phenyl]urea is Cc1cc(C)cc(NC(=O)Nc2ccccc2Oc2ccc([N+](=O)[O-])cc2)c1.
What is the InChIKey of 1-(3,5-dimethylphenyl)-3-[2-(4-nitrophenoxy)phenyl]urea?
The InChIKey is YLCCRQWTIKEJQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19N3O4/c1-14-11-15(2)13-16(12-14)22-21(25)23-19-5-3-4-6-20(19)28-18-9-7-17(8-10-18)24(26)27/h3-13H,1-2H3,(H2,22,23,25).
What are the key properties of 1-(3,5-dimethylphenyl)-3-[2-(4-nitrophenoxy)phenyl]urea?
1-(3,5-dimethylphenyl)-3-[2-(4-nitrophenoxy)phenyl]urea has a molecular weight of 377.40 g/mol, XLogP of 5.65, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,5-dimethylphenyl)-3-[2-(4-nitrophenoxy)phenyl]urea is sourced from PubChem (CID 18431146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).