C10H12N2OS2 — CID 18434022
2-methylsulfanyl-3-propylthieno[2,3-d]pyrimidin-4-one (PubChem CID 18434022) has the molecular formula C10H12N2OS2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 2-methylsulfanyl-3-propylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-methylsulfanyl-3-propylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 18434022 |
| Molecular Formula | C10H12N2OS2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | 2-methylsulfanyl-3-propylthieno[2,3-d]pyrimidin-4-one |
| SMILES | CCCn1c(SC)nc2sccc2c1=O |
| InChI | InChI=1S/C10H12N2OS2/c1-3-5-12-9(13)7-4-6-15-8(7)11-10(12)14-2/h4,6H,3,5H2,1-2H3 |
| InChIKey | HPSIHHXZIORIJX-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |