C19H18ClF4NO2 — CID 18434262
(2,4-difluorophenyl)-[4-[(E)-4-(dimethylamino)but-2-enoxy]-2,5-difluorophenyl]methanone;hydrochloride (PubChem CID 18434262) has the molecular formula C19H18ClF4NO2 and a molecular weight of 403.80 g/mol. Its IUPAC name is (2,4-difluorophenyl)-[4-[(E)-4-(dimethylamino)but-2-enoxy]-2,5-difluorophenyl]methanone;hydrochloride.
| Compound Name | (2,4-difluorophenyl)-[4-[(E)-4-(dimethylamino)but-2-enoxy]-2,5-difluorophenyl]methanone;hydrochloride |
|---|---|
| PubChem CID | 18434262 |
| Molecular Formula | C19H18ClF4NO2 |
| Molecular Weight | 403.80 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | (2,4-difluorophenyl)-[4-[(E)-4-(dimethylamino)but-2-enoxy]-2,5-difluorophenyl]methanone;hydrochloride |
| SMILES | CN(C)C/C=C/COc1cc(F)c(C(=O)c2ccc(F)cc2F)cc1F.Cl |
| InChI | InChI=1S/C19H17F4NO2.ClH/c1-24(2)7-3-4-8-26-18-11-16(22)14(10-17(18)23)19(25)13-6-5-12(20)9-15(13)21;/h3-6,9-11H,7-8H2,1-2H3;1H/b4-3+; |
| InChIKey | ZORNPUIOULQDEA-BJILWQEISA-N |
| XLogP | 4.39 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.80 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|