C28H26ClN3O — CID 18435919
4-(2-chlorophenyl)-N-[8-methyl-3-(pyrrolidin-1-ylmethyl)quinolin-7-yl]benzamide (PubChem CID 18435919) has the molecular formula C28H26ClN3O and a molecular weight of 455.99 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-N-[8-methyl-3-(pyrrolidin-1-ylmethyl)quinolin-7-yl]benzamide.
| Compound Name | 4-(2-chlorophenyl)-N-[8-methyl-3-(pyrrolidin-1-ylmethyl)quinolin-7-yl]benzamide |
|---|---|
| PubChem CID | 18435919 |
| Molecular Formula | C28H26ClN3O |
| Molecular Weight | 455.99 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | 4-(2-chlorophenyl)-N-[8-methyl-3-(pyrrolidin-1-ylmethyl)quinolin-7-yl]benzamide |
| SMILES | Cc1c(NC(=O)c2ccc(-c3ccccc3Cl)cc2)ccc2cc(CN3CCCC3)cnc12 |
| InChI | InChI=1S/C28H26ClN3O/c1-19-26(13-12-23-16-20(17-30-27(19)23)18-32-14-4-5-15-32)31-28(33)22-10-8-21(9-11-22)24-6-2-3-7-25(24)29/h2-3,6-13,16-17H,4-5,14-15,18H2,1H3,(H,31,33) |
| InChIKey | OKSHMKRSFHXLLE-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.99 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |