C28H26FN3O2 — CID 18436095
4-(4-fluorophenyl)-N-[8-methoxy-3-(pyrrolidin-1-ylmethyl)quinolin-7-yl]benzamide (PubChem CID 18436095) has the molecular formula C28H26FN3O2 and a molecular weight of 455.53 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N-[8-methoxy-3-(pyrrolidin-1-ylmethyl)quinolin-7-yl]benzamide.
| Compound Name | 4-(4-fluorophenyl)-N-[8-methoxy-3-(pyrrolidin-1-ylmethyl)quinolin-7-yl]benzamide |
|---|---|
| PubChem CID | 18436095 |
| Molecular Formula | C28H26FN3O2 |
| Molecular Weight | 455.53 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | 4-(4-fluorophenyl)-N-[8-methoxy-3-(pyrrolidin-1-ylmethyl)quinolin-7-yl]benzamide |
| SMILES | COc1c(NC(=O)c2ccc(-c3ccc(F)cc3)cc2)ccc2cc(CN3CCCC3)cnc12 |
| InChI | InChI=1S/C28H26FN3O2/c1-34-27-25(13-10-23-16-19(17-30-26(23)27)18-32-14-2-3-15-32)31-28(33)22-6-4-20(5-7-22)21-8-11-24(29)12-9-21/h4-13,16-17H,2-3,14-15,18H2,1H3,(H,31,33) |
| InChIKey | VQLSRZQYBLRCNJ-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.53 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |