C31H28FN5O — CID 67269461
N-(2-aminophenyl)-4-[3-cyano-5-[[3-(4-fluorophenyl)piperidin-1-yl]methyl]-2-pyridinyl]benzamide (PubChem CID 67269461) has the molecular formula C31H28FN5O and a molecular weight of 505.60 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[3-cyano-5-[[3-(4-fluorophenyl)piperidin-1-yl]methyl]-2-pyridinyl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[3-cyano-5-[[3-(4-fluorophenyl)piperidin-1-yl]methyl]-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 67269461 |
| Molecular Formula | C31H28FN5O |
| Molecular Weight | 505.60 g/mol |
| Exact Mass | 505.23 |
| IUPAC Name | N-(2-aminophenyl)-4-[3-cyano-5-[[3-(4-fluorophenyl)piperidin-1-yl]methyl]-2-pyridinyl]benzamide |
| SMILES | N#Cc1cc(CN2CCCC(c3ccc(F)cc3)C2)cnc1-c1ccc(C(=O)Nc2ccccc2N)cc1 |
| InChI | InChI=1S/C31H28FN5O/c32-27-13-11-22(12-14-27)25-4-3-15-37(20-25)19-21-16-26(17-33)30(35-18-21)23-7-9-24(10-8-23)31(38)36-29-6-2-1-5-28(29)34/h1-2,5-14,16,18,25H,3-4,15,19-20,34H2,(H,36,38) |
| InChIKey | MRERGFAUHZXJHV-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 95.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.60 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|