C26H24F3N5O — CID 11583810
N-(2-aminophenyl)-4-[3-cyano-5-[[4-(trifluoromethyl)piperidin-1-yl]methyl]-2-pyridinyl]benzamide (PubChem CID 11583810) has the molecular formula C26H24F3N5O and a molecular weight of 479.51 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[3-cyano-5-[[4-(trifluoromethyl)piperidin-1-yl]methyl]-2-pyridinyl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[3-cyano-5-[[4-(trifluoromethyl)piperidin-1-yl]methyl]-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 11583810 |
| Molecular Formula | C26H24F3N5O |
| Molecular Weight | 479.51 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | N-(2-aminophenyl)-4-[3-cyano-5-[[4-(trifluoromethyl)piperidin-1-yl]methyl]-2-pyridinyl]benzamide |
| SMILES | N#Cc1cc(CN2CCC(C(F)(F)F)CC2)cnc1-c1ccc(C(=O)Nc2ccccc2N)cc1 |
| InChI | InChI=1S/C26H24F3N5O/c27-26(28,29)21-9-11-34(12-10-21)16-17-13-20(14-30)24(32-15-17)18-5-7-19(8-6-18)25(35)33-23-4-2-1-3-22(23)31/h1-8,13,15,21H,9-12,16,31H2,(H,33,35) |
| InChIKey | NFMUKCXQGBRQKR-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 95.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.51 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|