C31H28N6O — CID 67269909
N-(2-aminophenyl)-4-[3-cyano-5-[[2-(2-methyl-1H-indol-3-yl)ethylamino]methyl]-2-pyridinyl]benzamide (PubChem CID 67269909) has the molecular formula C31H28N6O and a molecular weight of 500.61 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[3-cyano-5-[[2-(2-methyl-1H-indol-3-yl)ethylamino]methyl]-2-pyridinyl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[3-cyano-5-[[2-(2-methyl-1H-indol-3-yl)ethylamino]methyl]-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 67269909 |
| Molecular Formula | C31H28N6O |
| Molecular Weight | 500.61 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | N-(2-aminophenyl)-4-[3-cyano-5-[[2-(2-methyl-1H-indol-3-yl)ethylamino]methyl]-2-pyridinyl]benzamide |
| SMILES | Cc1[nH]c2ccccc2c1CCNCc1cnc(-c2ccc(C(=O)Nc3ccccc3N)cc2)c(C#N)c1 |
| InChI | InChI=1S/C31H28N6O/c1-20-25(26-6-2-4-8-28(26)36-20)14-15-34-18-21-16-24(17-32)30(35-19-21)22-10-12-23(13-11-22)31(38)37-29-9-5-3-7-27(29)33/h2-13,16,19,34,36H,14-15,18,33H2,1H3,(H,37,38) |
| InChIKey | VEJWSOGARQCTMM-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 119.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.61 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|