C30H30F2N3O4+ — CID 18438162
1,1-bis(1,3-benzodioxol-5-yl)-N-[[3-butyl-5-(difluoromethyl)-2-phenyl-1H-imidazol-3-ium-4-yl]methyl]methanamine (PubChem CID 18438162) has the molecular formula C30H30F2N3O4+ and a molecular weight of 534.58 g/mol. Its IUPAC name is 1,1-bis(1,3-benzodioxol-5-yl)-N-[[3-butyl-5-(difluoromethyl)-2-phenyl-1H-imidazol-3-ium-4-yl]methyl]methanamine.
| Compound Name | 1,1-bis(1,3-benzodioxol-5-yl)-N-[[3-butyl-5-(difluoromethyl)-2-phenyl-1H-imidazol-3-ium-4-yl]methyl]methanamine |
|---|---|
| PubChem CID | 18438162 |
| Molecular Formula | C30H30F2N3O4+ |
| Molecular Weight | 534.58 g/mol |
| Exact Mass | 534.22 |
| IUPAC Name | 1,1-bis(1,3-benzodioxol-5-yl)-N-[[3-butyl-5-(difluoromethyl)-2-phenyl-1H-imidazol-3-ium-4-yl]methyl]methanamine |
| SMILES | CCCC[n+]1c(-c2ccccc2)[nH]c(C(F)F)c1CNC(c1ccc2c(c1)OCO2)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C30H29F2N3O4/c1-2-3-13-35-22(28(29(31)32)34-30(35)19-7-5-4-6-8-19)16-33-27(20-9-11-23-25(14-20)38-17-36-23)21-10-12-24-26(15-21)39-18-37-24/h4-12,14-15,27,29,33H,2-3,13,16-18H2,1H3/p+1 |
| InChIKey | KACVJLPXUIKEMW-UHFFFAOYSA-O |
| XLogP | 6.04 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.58 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|