About [3-[2-(5-ethylsulfonyl-2-methoxyanilino)-1,3-oxazol-5-yl]phenyl] benzoate
[3-[2-(5-ethylsulfonyl-2-methoxyanilino)-1,3-oxazol-5-yl]phenyl] benzoate (PubChem CID 18439660) has the molecular formula C25H22N2O6S
and a molecular weight of 478.53 g/mol. Its IUPAC name is [3-[2-(5-ethylsulfonyl-2-methoxyanilino)-1,3-oxazol-5-yl]phenyl] benzoate.
Molecular Properties
| Compound Name | [3-[2-(5-ethylsulfonyl-2-methoxyanilino)-1,3-oxazol-5-yl]phenyl] benzoate |
| PubChem CID | 18439660 |
| Molecular Formula | C25H22N2O6S |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | [3-[2-(5-ethylsulfonyl-2-methoxyanilino)-1,3-oxazol-5-yl]phenyl] benzoate |
| SMILES | CCS(=O)(=O)c1ccc(OC)c(Nc2ncc(-c3cccc(OC(=O)c4ccccc4)c3)o2)c1 |
| InChI | InChI=1S/C25H22N2O6S/c1-3-34(29,30)20-12-13-22(31-2)21(15-20)27-25-26-16-23(33-25)18-10-7-11-19(14-18)32-24(28)17-8-5-4-6-9-17/h4-16H,3H2,1-2H3,(H,26,27) |
| InChIKey | MPHXGBQTNIUJIZ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 107.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-[2-(5-ethylsulfonyl-2-methoxyanilino)-1,3-oxazol-5-yl]phenyl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[2-(5-ethylsulfonyl-2-methoxyanilino)-1,3-oxazol-5-yl]phenyl] benzoate?
The IUPAC name of [3-[2-(5-ethylsulfonyl-2-methoxyanilino)-1,3-oxazol-5-yl]phenyl] benzoate (CID 18439660) is [3-[2-(5-ethylsulfonyl-2-methoxyanilino)-1,3-oxazol-5-yl]phenyl] benzoate.
What is the SMILES notation for [3-[2-(5-ethylsulfonyl-2-methoxyanilino)-1,3-oxazol-5-yl]phenyl] benzoate?
The canonical SMILES for [3-[2-(5-ethylsulfonyl-2-methoxyanilino)-1,3-oxazol-5-yl]phenyl] benzoate is CCS(=O)(=O)c1ccc(OC)c(Nc2ncc(-c3cccc(OC(=O)c4ccccc4)c3)o2)c1.
What is the InChIKey of [3-[2-(5-ethylsulfonyl-2-methoxyanilino)-1,3-oxazol-5-yl]phenyl] benzoate?
The InChIKey is MPHXGBQTNIUJIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H22N2O6S/c1-3-34(29,30)20-12-13-22(31-2)21(15-20)27-25-26-16-23(33-25)18-10-7-11-19(14-18)32-24(28)17-8-5-4-6-9-17/h4-16H,3H2,1-2H3,(H,26,27).
What are the key properties of [3-[2-(5-ethylsulfonyl-2-methoxyanilino)-1,3-oxazol-5-yl]phenyl] benzoate?
[3-[2-(5-ethylsulfonyl-2-methoxyanilino)-1,3-oxazol-5-yl]phenyl] benzoate has a molecular weight of 478.53 g/mol, XLogP of 5.11, 8 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[2-(5-ethylsulfonyl-2-methoxyanilino)-1,3-oxazol-5-yl]phenyl] benzoate is sourced from PubChem (CID 18439660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).