C25H22N2O6S — CID 18439660
[3-[2-(5-ethylsulfonyl-2-methoxyanilino)-1,3-oxazol-5-yl]phenyl] benzoate (PubChem CID 18439660) has the molecular formula C25H22N2O6S and a molecular weight of 478.53 g/mol. Its IUPAC name is [3-[2-(5-ethylsulfonyl-2-methoxyanilino)-1,3-oxazol-5-yl]phenyl] benzoate.
| Compound Name | [3-[2-(5-ethylsulfonyl-2-methoxyanilino)-1,3-oxazol-5-yl]phenyl] benzoate |
|---|---|
| PubChem CID | 18439660 |
| Molecular Formula | C25H22N2O6S |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | [3-[2-(5-ethylsulfonyl-2-methoxyanilino)-1,3-oxazol-5-yl]phenyl] benzoate |
| SMILES | CCS(=O)(=O)c1ccc(OC)c(Nc2ncc(-c3cccc(OC(=O)c4ccccc4)c3)o2)c1 |
| InChI | InChI=1S/C25H22N2O6S/c1-3-34(29,30)20-12-13-22(31-2)21(15-20)27-25-26-16-23(33-25)18-10-7-11-19(14-18)32-24(28)17-8-5-4-6-9-17/h4-16H,3H2,1-2H3,(H,26,27) |
| InChIKey | MPHXGBQTNIUJIZ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 107.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|