C19H12F3N3O2 — CID 18440014
3-[5-[(6-oxo-1H-pyridazin-3-yl)methyl]-2-(trifluoromethyl)phenoxy]benzonitrile (PubChem CID 18440014) has the molecular formula C19H12F3N3O2 and a molecular weight of 371.32 g/mol. Its IUPAC name is 3-[5-[(6-oxo-1H-pyridazin-3-yl)methyl]-2-(trifluoromethyl)phenoxy]benzonitrile.
| Compound Name | 3-[5-[(6-oxo-1H-pyridazin-3-yl)methyl]-2-(trifluoromethyl)phenoxy]benzonitrile |
|---|---|
| PubChem CID | 18440014 |
| Molecular Formula | C19H12F3N3O2 |
| Molecular Weight | 371.32 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 3-[5-[(6-oxo-1H-pyridazin-3-yl)methyl]-2-(trifluoromethyl)phenoxy]benzonitrile |
| SMILES | N#Cc1cccc(Oc2cc(Cc3ccc(=O)[nH]n3)ccc2C(F)(F)F)c1 |
| InChI | InChI=1S/C19H12F3N3O2/c20-19(21,22)16-6-4-12(8-14-5-7-18(26)25-24-14)10-17(16)27-15-3-1-2-13(9-15)11-23/h1-7,9-10H,8H2,(H,25,26) |
| InChIKey | CPVVJLAXETYYCQ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 78.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.32 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |