C17H11ClN4O2 — CID 18440104
6-[2-chloro-5-[(6-oxo-1H-pyridazin-3-yl)methyl]phenoxy]pyridine-2-carbonitrile (PubChem CID 18440104) has the molecular formula C17H11ClN4O2 and a molecular weight of 338.75 g/mol. Its IUPAC name is 6-[2-chloro-5-[(6-oxo-1H-pyridazin-3-yl)methyl]phenoxy]pyridine-2-carbonitrile.
| Compound Name | 6-[2-chloro-5-[(6-oxo-1H-pyridazin-3-yl)methyl]phenoxy]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 18440104 |
| Molecular Formula | C17H11ClN4O2 |
| Molecular Weight | 338.75 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 6-[2-chloro-5-[(6-oxo-1H-pyridazin-3-yl)methyl]phenoxy]pyridine-2-carbonitrile |
| SMILES | N#Cc1cccc(Oc2cc(Cc3ccc(=O)[nH]n3)ccc2Cl)n1 |
| InChI | InChI=1S/C17H11ClN4O2/c18-14-6-4-11(8-12-5-7-16(23)22-21-12)9-15(14)24-17-3-1-2-13(10-19)20-17/h1-7,9H,8H2,(H,22,23) |
| InChIKey | VCWIOCLHSWDWNZ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.75 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |