C20H13ClN4O2 — CID 58820023
2-[2-chloro-5-[(5-methyl-6-oxo-1H-pyridazin-3-yl)methyl]phenoxy]-6-isocyanobenzonitrile (PubChem CID 58820023) has the molecular formula C20H13ClN4O2 and a molecular weight of 376.80 g/mol. Its IUPAC name is 2-[2-chloro-5-[(5-methyl-6-oxo-1H-pyridazin-3-yl)methyl]phenoxy]-6-isocyanobenzonitrile.
| Compound Name | 2-[2-chloro-5-[(5-methyl-6-oxo-1H-pyridazin-3-yl)methyl]phenoxy]-6-isocyanobenzonitrile |
|---|---|
| PubChem CID | 58820023 |
| Molecular Formula | C20H13ClN4O2 |
| Molecular Weight | 376.80 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | 2-[2-chloro-5-[(5-methyl-6-oxo-1H-pyridazin-3-yl)methyl]phenoxy]-6-isocyanobenzonitrile |
| SMILES | [C-]#[N+]c1cccc(Oc2cc(Cc3cc(C)c(=O)[nH]n3)ccc2Cl)c1C#N |
| InChI | InChI=1S/C20H13ClN4O2/c1-12-8-14(24-25-20(12)26)9-13-6-7-16(21)19(10-13)27-18-5-3-4-17(23-2)15(18)11-22/h3-8,10H,9H2,1H3,(H,25,26) |
| InChIKey | ZKGXMTWVNKKGMB-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 83.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.80 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|