C26H33ClN4O4 — CID 18444294
[(2S,5R)-4-(4-aminophenyl)-2,5-dimethylpiperazin-1-yl]-[6-(3,4-dimethoxyphenyl)-2-pyridinyl]methanone;hydrate;hydrochloride (PubChem CID 18444294) has the molecular formula C26H33ClN4O4 and a molecular weight of 501.03 g/mol. Its IUPAC name is [(2S,5R)-4-(4-aminophenyl)-2,5-dimethylpiperazin-1-yl]-[6-(3,4-dimethoxyphenyl)-2-pyridinyl]methanone;hydrate;hydrochloride.
| Compound Name | [(2S,5R)-4-(4-aminophenyl)-2,5-dimethylpiperazin-1-yl]-[6-(3,4-dimethoxyphenyl)-2-pyridinyl]methanone;hydrate;hydrochloride |
|---|---|
| PubChem CID | 18444294 |
| Molecular Formula | C26H33ClN4O4 |
| Molecular Weight | 501.03 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | [(2S,5R)-4-(4-aminophenyl)-2,5-dimethylpiperazin-1-yl]-[6-(3,4-dimethoxyphenyl)-2-pyridinyl]methanone;hydrate;hydrochloride |
| SMILES | COc1ccc(-c2cccc(C(=O)N3C[C@@H](C)N(c4ccc(N)cc4)C[C@@H]3C)n2)cc1OC.Cl.O |
| InChI | InChI=1S/C26H30N4O3.ClH.H2O/c1-17-16-30(18(2)15-29(17)21-11-9-20(27)10-12-21)26(31)23-7-5-6-22(28-23)19-8-13-24(32-3)25(14-19)33-4;;/h5-14,17-18H,15-16,27H2,1-4H3;1H;1H2/t17-,18+;;/m1../s1 |
| InChIKey | RWOTYRPIIYKNHB-WCRQIBMVSA-N |
| XLogP | 3.68 |
| TPSA | 112.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.03 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|