C13H17NO5S — CID 18446408
S-(6-benzyl-3,4,5-trihydroxyoxan-2-yl) carbamothioate (PubChem CID 18446408) has the molecular formula C13H17NO5S and a molecular weight of 299.35 g/mol. Its IUPAC name is S-(6-benzyl-3,4,5-trihydroxyoxan-2-yl) carbamothioate.
| Compound Name | S-(6-benzyl-3,4,5-trihydroxyoxan-2-yl) carbamothioate |
|---|---|
| PubChem CID | 18446408 |
| Molecular Formula | C13H17NO5S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | S-(6-benzyl-3,4,5-trihydroxyoxan-2-yl) carbamothioate |
| SMILES | NC(=O)SC1OC(Cc2ccccc2)C(O)C(O)C1O |
| InChI | InChI=1S/C13H17NO5S/c14-13(18)20-12-11(17)10(16)9(15)8(19-12)6-7-4-2-1-3-5-7/h1-5,8-12,15-17H,6H2,(H2,14,18) |
| InChIKey | SPYXODQWRJWOSY-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|