C17H22N4O3 — CID 18447853
(7aR)-2-(4-morpholin-4-ylphenyl)-3-oxo-1,5,6,7-tetrahydropyrrolo[1,2-c]imidazole-7a-carboxamide (PubChem CID 18447853) has the molecular formula C17H22N4O3 and a molecular weight of 330.39 g/mol. Its IUPAC name is (7aR)-2-(4-morpholin-4-ylphenyl)-3-oxo-1,5,6,7-tetrahydropyrrolo[1,2-c]imidazole-7a-carboxamide.
| Compound Name | (7aR)-2-(4-morpholin-4-ylphenyl)-3-oxo-1,5,6,7-tetrahydropyrrolo[1,2-c]imidazole-7a-carboxamide |
|---|---|
| PubChem CID | 18447853 |
| Molecular Formula | C17H22N4O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | (7aR)-2-(4-morpholin-4-ylphenyl)-3-oxo-1,5,6,7-tetrahydropyrrolo[1,2-c]imidazole-7a-carboxamide |
| SMILES | NC(=O)[C@]12CCCN1C(=O)N(c1ccc(N3CCOCC3)cc1)C2 |
| InChI | InChI=1S/C17H22N4O3/c18-15(22)17-6-1-7-21(17)16(23)20(12-17)14-4-2-13(3-5-14)19-8-10-24-11-9-19/h2-5H,1,6-12H2,(H2,18,22)/t17-/m1/s1 |
| InChIKey | GZZSDAMFUVGOSA-QGZVFWFLSA-N |
| XLogP | 0.78 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|