C22H31FN4O3 — CID 125227616
(3aR,6aS)-5-ethyl-N-(4-fluorophenyl)-2-(2-methoxyethyl)-6-oxospiro[1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,4'-piperidine]-1'-carboxamide (PubChem CID 125227616) has the molecular formula C22H31FN4O3 and a molecular weight of 418.51 g/mol. Its IUPAC name is (3aR,6aS)-5-ethyl-N-(4-fluorophenyl)-2-(2-methoxyethyl)-6-oxospiro[1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,4'-piperidine]-1'-carboxamide.
| Compound Name | (3aR,6aS)-5-ethyl-N-(4-fluorophenyl)-2-(2-methoxyethyl)-6-oxospiro[1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,4'-piperidine]-1'-carboxamide |
|---|---|
| PubChem CID | 125227616 |
| Molecular Formula | C22H31FN4O3 |
| Molecular Weight | 418.51 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | (3aR,6aS)-5-ethyl-N-(4-fluorophenyl)-2-(2-methoxyethyl)-6-oxospiro[1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,4'-piperidine]-1'-carboxamide |
| SMILES | CCN1C(=O)[C@@H]2CN(CCOC)C[C@@H]2C12CCN(C(=O)Nc1ccc(F)cc1)CC2 |
| InChI | InChI=1S/C22H31FN4O3/c1-3-27-20(28)18-14-25(12-13-30-2)15-19(18)22(27)8-10-26(11-9-22)21(29)24-17-6-4-16(23)5-7-17/h4-7,18-19H,3,8-15H2,1-2H3,(H,24,29)/t18-,19+/m1/s1 |
| InChIKey | GIAFBDWXPNGQMT-MOPGFXCFSA-N |
| XLogP | 2.25 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.51 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |