C18H20F2NO5PS — CID 18448051
[2-amino-4-[5-[3-(3,5-difluorophenoxy)prop-1-ynyl]thiophen-2-yl]-2-methylbutyl] dihydrogen phosphate (PubChem CID 18448051) has the molecular formula C18H20F2NO5PS and a molecular weight of 431.40 g/mol. Its IUPAC name is [2-amino-4-[5-[3-(3,5-difluorophenoxy)prop-1-ynyl]thiophen-2-yl]-2-methylbutyl] dihydrogen phosphate.
| Compound Name | [2-amino-4-[5-[3-(3,5-difluorophenoxy)prop-1-ynyl]thiophen-2-yl]-2-methylbutyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 18448051 |
| Molecular Formula | C18H20F2NO5PS |
| Molecular Weight | 431.40 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | [2-amino-4-[5-[3-(3,5-difluorophenoxy)prop-1-ynyl]thiophen-2-yl]-2-methylbutyl] dihydrogen phosphate |
| SMILES | CC(N)(CCc1ccc(C#CCOc2cc(F)cc(F)c2)s1)COP(=O)(O)O |
| InChI | InChI=1S/C18H20F2NO5PS/c1-18(21,12-26-27(22,23)24)7-6-17-5-4-16(28-17)3-2-8-25-15-10-13(19)9-14(20)11-15/h4-5,9-11H,6-8,12,21H2,1H3,(H2,22,23,24) |
| InChIKey | HXBJOFFMMGFEAY-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|