C20H22F3NO2S — CID 22279742
2-amino-2-methyl-4-[5-[4-[3-(trifluoromethyl)phenoxy]but-1-ynyl]thiophen-2-yl]butan-1-ol (PubChem CID 22279742) has the molecular formula C20H22F3NO2S and a molecular weight of 397.46 g/mol. Its IUPAC name is 2-amino-2-methyl-4-[5-[4-[3-(trifluoromethyl)phenoxy]but-1-ynyl]thiophen-2-yl]butan-1-ol.
| Compound Name | 2-amino-2-methyl-4-[5-[4-[3-(trifluoromethyl)phenoxy]but-1-ynyl]thiophen-2-yl]butan-1-ol |
|---|---|
| PubChem CID | 22279742 |
| Molecular Formula | C20H22F3NO2S |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | 2-amino-2-methyl-4-[5-[4-[3-(trifluoromethyl)phenoxy]but-1-ynyl]thiophen-2-yl]butan-1-ol |
| SMILES | CC(N)(CO)CCc1ccc(C#CCCOc2cccc(C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C20H22F3NO2S/c1-19(24,14-25)11-10-18-9-8-17(27-18)7-2-3-12-26-16-6-4-5-15(13-16)20(21,22)23/h4-6,8-9,13,25H,3,10-12,14,24H2,1H3 |
| InChIKey | CJPZVGCLQIRANY-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|