C20H24F3NO3S — CID 22279733
1-[5-(3-amino-4-hydroxy-3-methylbutyl)thiophen-2-yl]-4-[3-(trifluoromethyl)phenoxy]butan-1-one (PubChem CID 22279733) has the molecular formula C20H24F3NO3S and a molecular weight of 415.48 g/mol. Its IUPAC name is 1-[5-(3-amino-4-hydroxy-3-methylbutyl)thiophen-2-yl]-4-[3-(trifluoromethyl)phenoxy]butan-1-one.
| Compound Name | 1-[5-(3-amino-4-hydroxy-3-methylbutyl)thiophen-2-yl]-4-[3-(trifluoromethyl)phenoxy]butan-1-one |
|---|---|
| PubChem CID | 22279733 |
| Molecular Formula | C20H24F3NO3S |
| Molecular Weight | 415.48 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | 1-[5-(3-amino-4-hydroxy-3-methylbutyl)thiophen-2-yl]-4-[3-(trifluoromethyl)phenoxy]butan-1-one |
| SMILES | CC(N)(CO)CCc1ccc(C(=O)CCCOc2cccc(C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C20H24F3NO3S/c1-19(24,13-25)10-9-16-7-8-18(28-16)17(26)6-3-11-27-15-5-2-4-14(12-15)20(21,22)23/h2,4-5,7-8,12,25H,3,6,9-11,13,24H2,1H3 |
| InChIKey | MPEIHVLFLJUDEK-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.48 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|