C19H20F3NO2S — CID 22728168
2-amino-2-methyl-4-[5-[3-[3-(trifluoromethyl)phenoxy]prop-1-ynyl]thiophen-2-yl]butan-1-ol (PubChem CID 22728168) has the molecular formula C19H20F3NO2S and a molecular weight of 383.44 g/mol. Its IUPAC name is 2-amino-2-methyl-4-[5-[3-[3-(trifluoromethyl)phenoxy]prop-1-ynyl]thiophen-2-yl]butan-1-ol.
| Compound Name | 2-amino-2-methyl-4-[5-[3-[3-(trifluoromethyl)phenoxy]prop-1-ynyl]thiophen-2-yl]butan-1-ol |
|---|---|
| PubChem CID | 22728168 |
| Molecular Formula | C19H20F3NO2S |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 2-amino-2-methyl-4-[5-[3-[3-(trifluoromethyl)phenoxy]prop-1-ynyl]thiophen-2-yl]butan-1-ol |
| SMILES | CC(N)(CO)CCc1ccc(C#CCOc2cccc(C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C19H20F3NO2S/c1-18(23,13-24)10-9-17-8-7-16(26-17)6-3-11-25-15-5-2-4-14(12-15)19(20,21)22/h2,4-5,7-8,12,24H,9-11,13,23H2,1H3 |
| InChIKey | GDVUICBUFVAPQL-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|