C20H24N2O — CID 18449743
N-(2-aminophenyl)-2-(1-phenylcyclohexyl)acetamide (PubChem CID 18449743) has the molecular formula C20H24N2O and a molecular weight of 308.43 g/mol. Its IUPAC name is N-(2-aminophenyl)-2-(1-phenylcyclohexyl)acetamide.
| Compound Name | N-(2-aminophenyl)-2-(1-phenylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 18449743 |
| Molecular Formula | C20H24N2O |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | N-(2-aminophenyl)-2-(1-phenylcyclohexyl)acetamide |
| SMILES | Nc1ccccc1NC(=O)CC1(c2ccccc2)CCCCC1 |
| InChI | InChI=1S/C20H24N2O/c21-17-11-5-6-12-18(17)22-19(23)15-20(13-7-2-8-14-20)16-9-3-1-4-10-16/h1,3-6,9-12H,2,7-8,13-15,21H2,(H,22,23) |
| InChIKey | SJOYGHGKAKOKNW-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|