C23H13F5N2O3S — CID 18457077
2-[bis(4-fluorophenyl)-[4-nitro-3-(trifluoromethyl)phenoxy]methyl]-1,3-thiazole (PubChem CID 18457077) has the molecular formula C23H13F5N2O3S and a molecular weight of 492.43 g/mol. Its IUPAC name is 2-[bis(4-fluorophenyl)-[4-nitro-3-(trifluoromethyl)phenoxy]methyl]-1,3-thiazole.
| Compound Name | 2-[bis(4-fluorophenyl)-[4-nitro-3-(trifluoromethyl)phenoxy]methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 18457077 |
| Molecular Formula | C23H13F5N2O3S |
| Molecular Weight | 492.43 g/mol |
| Exact Mass | 492.06 |
| IUPAC Name | 2-[bis(4-fluorophenyl)-[4-nitro-3-(trifluoromethyl)phenoxy]methyl]-1,3-thiazole |
| SMILES | O=[N+]([O-])c1ccc(OC(c2ccc(F)cc2)(c2ccc(F)cc2)c2nccs2)cc1C(F)(F)F |
| InChI | InChI=1S/C23H13F5N2O3S/c24-16-5-1-14(2-6-16)22(21-29-11-12-34-21,15-3-7-17(25)8-4-15)33-18-9-10-20(30(31)32)19(13-18)23(26,27)28/h1-13H |
| InChIKey | DJQFWSKBYBTPDY-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 65.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.43 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|