C7H12F3N — CID 18457685
1-(1,2,2-trifluoroethyl)piperidine (PubChem CID 18457685) has the molecular formula C7H12F3N and a molecular weight of 167.17 g/mol. Its IUPAC name is 1-(1,2,2-trifluoroethyl)piperidine.
| Compound Name | 1-(1,2,2-trifluoroethyl)piperidine |
|---|---|
| PubChem CID | 18457685 |
| Molecular Formula | C7H12F3N |
| Molecular Weight | 167.17 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | 1-(1,2,2-trifluoroethyl)piperidine |
| SMILES | FC(F)C(F)N1CCCCC1 |
| InChI | InChI=1S/C7H12F3N/c8-6(9)7(10)11-4-2-1-3-5-11/h6-7H,1-5H2 |
| InChIKey | BFUKYRFPYIYKGD-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.17 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|