C16H32N4O6 — CID 18458014
1,3,5,7-tetrakis(methoxymethyl)-4-methyl-8-propyl-1,3,5,7-tetrazocane-2,6-dione (PubChem CID 18458014) has the molecular formula C16H32N4O6 and a molecular weight of 376.45 g/mol. Its IUPAC name is 1,3,5,7-tetrakis(methoxymethyl)-4-methyl-8-propyl-1,3,5,7-tetrazocane-2,6-dione.
| Compound Name | 1,3,5,7-tetrakis(methoxymethyl)-4-methyl-8-propyl-1,3,5,7-tetrazocane-2,6-dione |
|---|---|
| PubChem CID | 18458014 |
| Molecular Formula | C16H32N4O6 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | 1,3,5,7-tetrakis(methoxymethyl)-4-methyl-8-propyl-1,3,5,7-tetrazocane-2,6-dione |
| SMILES | CCCC1N(COC)C(=O)N(COC)C(C)N(COC)C(=O)N1COC |
| InChI | InChI=1S/C16H32N4O6/c1-7-8-14-19(11-25-5)15(21)17(9-23-3)13(2)18(10-24-4)16(22)20(14)12-26-6/h13-14H,7-12H2,1-6H3 |
| InChIKey | ZOWURMPZRCCJBV-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 84.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |