C16H21OTi- — CID 18458100
3-tert-butyl-5-methylphenol;cyclopenta-1,3-diene;titanium (PubChem CID 18458100) has the molecular formula C16H21OTi- and a molecular weight of 277.21 g/mol. Its IUPAC name is 3-tert-butyl-5-methylphenol;cyclopenta-1,3-diene;titanium.
| Compound Name | 3-tert-butyl-5-methylphenol;cyclopenta-1,3-diene;titanium |
|---|---|
| PubChem CID | 18458100 |
| Molecular Formula | C16H21OTi- |
| Molecular Weight | 277.21 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 3-tert-butyl-5-methylphenol;cyclopenta-1,3-diene;titanium |
| SMILES | Cc1cc(O)cc(C(C)(C)C)c1.[C-]1=CC=CC1.[Ti] |
| InChI | InChI=1S/C11H16O.C5H5.Ti/c1-8-5-9(11(2,3)4)7-10(12)6-8;1-2-4-5-3-1;/h5-7,12H,1-4H3;1-3H,4H2;/q;-1; |
| InChIKey | KFHROELGXDFEOA-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.21 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|