C28H29OTi — CID 87665704
benzhydrylidenetitanium(1+);3-tert-butylphenol;cyclopenta-1,3-diene (PubChem CID 87665704) has the molecular formula C28H29OTi and a molecular weight of 429.41 g/mol. Its IUPAC name is benzhydrylidenetitanium(1+);3-tert-butylphenol;cyclopenta-1,3-diene.
| Compound Name | benzhydrylidenetitanium(1+);3-tert-butylphenol;cyclopenta-1,3-diene |
|---|---|
| PubChem CID | 87665704 |
| Molecular Formula | C28H29OTi |
| Molecular Weight | 429.41 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | benzhydrylidenetitanium(1+);3-tert-butylphenol;cyclopenta-1,3-diene |
| SMILES | CC(C)(C)c1cccc(O)c1.[C-]1=CC=CC1.[Ti+]=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H10.C10H14O.C5H5.Ti/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;1-10(2,3)8-5-4-6-9(11)7-8;1-2-4-5-3-1;/h1-10H;4-7,11H,1-3H3;1-3H,4H2;/q;;-1;+1 |
| InChIKey | BVJBKMBEPMPXAX-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.41 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|