About (4-methoxy-3,5-dimethyl-2-pyridinyl)methanol;hydrochloride
(4-methoxy-3,5-dimethyl-2-pyridinyl)methanol;hydrochloride (PubChem CID 18459077) has the molecular formula C9H14ClNO2
and a molecular weight of 203.67 g/mol. Its IUPAC name is (4-methoxy-3,5-dimethyl-2-pyridinyl)methanol;hydrochloride.
Molecular Properties
| Compound Name | (4-methoxy-3,5-dimethyl-2-pyridinyl)methanol;hydrochloride |
| PubChem CID | 18459077 |
| Molecular Formula | C9H14ClNO2 |
| Molecular Weight | 203.67 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | (4-methoxy-3,5-dimethyl-2-pyridinyl)methanol;hydrochloride |
| SMILES | COc1c(C)cnc(CO)c1C.Cl |
| InChI | InChI=1S/C9H13NO2.ClH/c1-6-4-10-8(5-11)7(2)9(6)12-3;/h4,11H,5H2,1-3H3;1H |
| InChIKey | QDZLOVCSHPNYIF-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.67 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-methoxy-3,5-dimethyl-2-pyridinyl)methanol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxy-3,5-dimethyl-2-pyridinyl)methanol;hydrochloride?
The IUPAC name of (4-methoxy-3,5-dimethyl-2-pyridinyl)methanol;hydrochloride (CID 18459077) is (4-methoxy-3,5-dimethyl-2-pyridinyl)methanol;hydrochloride.
What is the SMILES notation for (4-methoxy-3,5-dimethyl-2-pyridinyl)methanol;hydrochloride?
The canonical SMILES for (4-methoxy-3,5-dimethyl-2-pyridinyl)methanol;hydrochloride is COc1c(C)cnc(CO)c1C.Cl.
What is the InChIKey of (4-methoxy-3,5-dimethyl-2-pyridinyl)methanol;hydrochloride?
The InChIKey is QDZLOVCSHPNYIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO2.ClH/c1-6-4-10-8(5-11)7(2)9(6)12-3;/h4,11H,5H2,1-3H3;1H.
What are the key properties of (4-methoxy-3,5-dimethyl-2-pyridinyl)methanol;hydrochloride?
(4-methoxy-3,5-dimethyl-2-pyridinyl)methanol;hydrochloride has a molecular weight of 203.67 g/mol, XLogP of 1.62, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxy-3,5-dimethyl-2-pyridinyl)methanol;hydrochloride is sourced from PubChem (CID 18459077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).