C12H14ClN5O3S — CID 184639
Tizanidine lactate (PubChem CID 184639) has the molecular formula C12H14ClN5O3S and a molecular weight of 343.79 g/mol. Its IUPAC name is 5-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-2,1,3-benzothiadiazol-4-amine;2-hydroxypropanoic acid.
| Compound Name | Tizanidine lactate |
|---|---|
| PubChem CID | 184639 |
| Molecular Formula | C12H14ClN5O3S |
| Molecular Weight | 343.79 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | 5-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-2,1,3-benzothiadiazol-4-amine;2-hydroxypropanoic acid |
| SMILES | CC(C(=O)O)O.C1CN=C(N1)NC2=C(C=CC3=NSN=C32)Cl |
| InChI | InChI=1S/C9H8ClN5S.C3H6O3/c10-5-1-2-6-8(15-16-14-6)7(5)13-9-11-3-4-12-9;1-2(4)3(5)6/h1-2H,3-4H2,(H2,11,12,13);2,4H,1H3,(H,5,6) |
| InChIKey | LIVDAGUZLLMLHS-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 148.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | 359 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |