C9H8ClN5OS — CID 46781916
Hydroxy tizanidine, (+-)- (PubChem CID 46781916) has the molecular formula C9H8ClN5OS and a molecular weight of 269.71 g/mol. Its IUPAC name is 2-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]-4,5-dihydro-1H-imidazol-5-ol.
| Compound Name | Hydroxy tizanidine, (+-)- |
|---|---|
| PubChem CID | 46781916 |
| Molecular Formula | C9H8ClN5OS |
| Molecular Weight | 269.71 g/mol |
| Exact Mass | 269.01 |
| IUPAC Name | 2-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]-4,5-dihydro-1H-imidazol-5-ol |
| SMILES | C1C(NC(=N1)NC2=C(C=CC3=NSN=C32)Cl)O |
| InChI | InChI=1S/C9H8ClN5OS/c10-4-1-2-5-8(15-17-14-5)7(4)13-9-11-3-6(16)12-9/h1-2,6,16H,3H2,(H2,11,12,13) |
| InChIKey | LURMELDQBVJARZ-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 111.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | 331 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.71 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |