About Tizanidine EP Impurity F
Tizanidine EP Impurity F (PubChem CID 90989638) has the molecular formula C16H11Cl2N9S2
and a molecular weight of 464.40 g/mol. Its IUPAC name is 1,2-bis(5-chloro-2,1,3-benzothiadiazol-4-yl)-1-(4,5-dihydro-1H-imidazol-2-yl)guanidine.
Molecular Properties
| Compound Name | Tizanidine EP Impurity F |
| PubChem CID | 90989638 |
| Molecular Formula | C16H11Cl2N9S2 |
| Molecular Weight | 464.40 g/mol |
| Exact Mass | 463.00 |
| IUPAC Name | 1,2-bis(5-chloro-2,1,3-benzothiadiazol-4-yl)-1-(4,5-dihydro-1H-imidazol-2-yl)guanidine |
| SMILES | C1CN=C(N1)N(C2=C(C=CC3=NSN=C32)Cl)C(=NC4=C(C=CC5=NSN=C54)Cl)N |
| InChI | InChI=1S/C16H11Cl2N9S2/c17-7-1-3-9-12(25-28-23-9)11(7)22-15(19)27(16-20-5-6-21-16)14-8(18)2-4-10-13(14)26-29-24-10/h1-4H,5-6H2,(H2,19,22)(H,20,21) |
| InChIKey | AMVAMDQMQCTPQD-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 174.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | 683 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 464.40 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze Tizanidine EP Impurity F with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Tizanidine EP Impurity F?
The IUPAC name of Tizanidine EP Impurity F (CID 90989638) is 1,2-bis(5-chloro-2,1,3-benzothiadiazol-4-yl)-1-(4,5-dihydro-1H-imidazol-2-yl)guanidine.
What is the SMILES notation for Tizanidine EP Impurity F?
The canonical SMILES for Tizanidine EP Impurity F is C1CN=C(N1)N(C2=C(C=CC3=NSN=C32)Cl)C(=NC4=C(C=CC5=NSN=C54)Cl)N.
What is the InChIKey of Tizanidine EP Impurity F?
The InChIKey is AMVAMDQMQCTPQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11Cl2N9S2/c17-7-1-3-9-12(25-28-23-9)11(7)22-15(19)27(16-20-5-6-21-16)14-8(18)2-4-10-13(14)26-29-24-10/h1-4H,5-6H2,(H2,19,22)(H,20,21).
What are the key properties of Tizanidine EP Impurity F?
Tizanidine EP Impurity F has a molecular weight of 464.40 g/mol, XLogP of 2.80, 4 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for Tizanidine EP Impurity F is sourced from PubChem (CID 90989638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).