C16H11Cl2N9S2 — CID 90989638
1,2-bis(5-chloro-2,1,3-benzothiadiazol-4-yl)-1-(4,5-dihydro-1H-imidazol-2-yl)guanidine (PubChem CID 90989638) has the molecular formula C16H11Cl2N9S2 and a molecular weight of 464.37 g/mol. Its IUPAC name is 1,2-bis(5-chloro-2,1,3-benzothiadiazol-4-yl)-1-(4,5-dihydro-1H-imidazol-2-yl)guanidine.
| Compound Name | 1,2-bis(5-chloro-2,1,3-benzothiadiazol-4-yl)-1-(4,5-dihydro-1H-imidazol-2-yl)guanidine |
|---|---|
| PubChem CID | 90989638 |
| Molecular Formula | C16H11Cl2N9S2 |
| Molecular Weight | 464.37 g/mol |
| Exact Mass | 463.00 |
| IUPAC Name | 1,2-bis(5-chloro-2,1,3-benzothiadiazol-4-yl)-1-(4,5-dihydro-1H-imidazol-2-yl)guanidine |
| SMILES | N/C(=N\c1c(Cl)ccc2nsnc12)N(C1=NCCN1)c1c(Cl)ccc2nsnc12 |
| InChI | InChI=1S/C16H11Cl2N9S2/c17-7-1-3-9-12(25-28-23-9)11(7)22-15(19)27(16-20-5-6-21-16)14-8(18)2-4-10-13(14)26-29-24-10/h1-4H,5-6H2,(H2,19,22)(H,20,21) |
| InChIKey | AMVAMDQMQCTPQD-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 117.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.37 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|